C20H22FNO3S — CID 152976203
3-(cyclopentylmethylsulfonyl)-N-(3-fluoro-5-methylphenyl)benzamide (PubChem CID 152976203) has the molecular formula C20H22FNO3S and a molecular weight of 375.47 g/mol. Its IUPAC name is 3-(cyclopentylmethylsulfonyl)-N-(3-fluoro-5-methylphenyl)benzamide.
| Compound Name | 3-(cyclopentylmethylsulfonyl)-N-(3-fluoro-5-methylphenyl)benzamide |
|---|---|
| PubChem CID | 152976203 |
| Molecular Formula | C20H22FNO3S |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 3-(cyclopentylmethylsulfonyl)-N-(3-fluoro-5-methylphenyl)benzamide |
| SMILES | Cc1cc(F)cc(NC(=O)c2cccc(S(=O)(=O)CC3CCCC3)c2)c1 |
| InChI | InChI=1S/C20H22FNO3S/c1-14-9-17(21)12-18(10-14)22-20(23)16-7-4-8-19(11-16)26(24,25)13-15-5-2-3-6-15/h4,7-12,15H,2-3,5-6,13H2,1H3,(H,22,23) |
| InChIKey | UTLRAKBHEOFUKF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |