C20H22FNO4S — CID 159659770
N-(4-fluoro-3-methylphenyl)-3-[(3-hydroxycyclopentyl)methylsulfonyl]benzamide (PubChem CID 159659770) has the molecular formula C20H22FNO4S and a molecular weight of 391.46 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-3-[(3-hydroxycyclopentyl)methylsulfonyl]benzamide.
| Compound Name | N-(4-fluoro-3-methylphenyl)-3-[(3-hydroxycyclopentyl)methylsulfonyl]benzamide |
|---|---|
| PubChem CID | 159659770 |
| Molecular Formula | C20H22FNO4S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-3-[(3-hydroxycyclopentyl)methylsulfonyl]benzamide |
| SMILES | Cc1cc(NC(=O)c2cccc(S(=O)(=O)CC3CCC(O)C3)c2)ccc1F |
| InChI | InChI=1S/C20H22FNO4S/c1-13-9-16(6-8-19(13)21)22-20(24)15-3-2-4-18(11-15)27(25,26)12-14-5-7-17(23)10-14/h2-4,6,8-9,11,14,17,23H,5,7,10,12H2,1H3,(H,22,24) |
| InChIKey | MSQMAXVDCSPSAQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |