C23H35NO3S — CID 162215890
3-cyclohexyl-N-[4-[(3-methylphenyl)sulfonylmethyl]cyclohexyl]propanamide (PubChem CID 162215890) has the molecular formula C23H35NO3S and a molecular weight of 405.60 g/mol. Its IUPAC name is 3-cyclohexyl-N-[4-[(3-methylphenyl)sulfonylmethyl]cyclohexyl]propanamide.
| Compound Name | 3-cyclohexyl-N-[4-[(3-methylphenyl)sulfonylmethyl]cyclohexyl]propanamide |
|---|---|
| PubChem CID | 162215890 |
| Molecular Formula | C23H35NO3S |
| Molecular Weight | 405.60 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 3-cyclohexyl-N-[4-[(3-methylphenyl)sulfonylmethyl]cyclohexyl]propanamide |
| SMILES | Cc1cccc(S(=O)(=O)CC2CCC(NC(=O)CCC3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C23H35NO3S/c1-18-6-5-9-22(16-18)28(26,27)17-20-10-13-21(14-11-20)24-23(25)15-12-19-7-3-2-4-8-19/h5-6,9,16,19-21H,2-4,7-8,10-15,17H2,1H3,(H,24,25) |
| InChIKey | ZTLPLTMVNLQXPY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.60 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |