C13H15FO3S — CID 106496405
3-fluoro-5-(oxolan-2-ylmethylsulfanylmethyl)benzoic acid (PubChem CID 106496405) has the molecular formula C13H15FO3S and a molecular weight of 270.32 g/mol. Its IUPAC name is 3-fluoro-5-(oxolan-2-ylmethylsulfanylmethyl)benzoic acid.
| Compound Name | 3-fluoro-5-(oxolan-2-ylmethylsulfanylmethyl)benzoic acid |
|---|---|
| PubChem CID | 106496405 |
| Molecular Formula | C13H15FO3S |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 3-fluoro-5-(oxolan-2-ylmethylsulfanylmethyl)benzoic acid |
| SMILES | O=C(O)c1cc(F)cc(CSCC2CCCO2)c1 |
| InChI | InChI=1S/C13H15FO3S/c14-11-5-9(4-10(6-11)13(15)16)7-18-8-12-2-1-3-17-12/h4-6,12H,1-3,7-8H2,(H,15,16) |
| InChIKey | FCVIGPVRUBZBKB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |