C12H14ClFOS — CID 112815253
2-[(2-chloro-4-fluorophenyl)methylsulfanylmethyl]oxolane (PubChem CID 112815253) has the molecular formula C12H14ClFOS and a molecular weight of 260.76 g/mol. Its IUPAC name is 2-[(2-chloro-4-fluorophenyl)methylsulfanylmethyl]oxolane.
| Compound Name | 2-[(2-chloro-4-fluorophenyl)methylsulfanylmethyl]oxolane |
|---|---|
| PubChem CID | 112815253 |
| Molecular Formula | C12H14ClFOS |
| Molecular Weight | 260.76 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 2-[(2-chloro-4-fluorophenyl)methylsulfanylmethyl]oxolane |
| SMILES | Fc1ccc(CSCC2CCCO2)c(Cl)c1 |
| InChI | InChI=1S/C12H14ClFOS/c13-12-6-10(14)4-3-9(12)7-16-8-11-2-1-5-15-11/h3-4,6,11H,1-2,5,7-8H2 |
| InChIKey | AWPHJTHDPOEFKW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.76 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |