C13H16ClFO2 — CID 62607059
1-(2-chloro-4-fluorophenyl)-3-(oxolan-2-yl)propan-2-ol (PubChem CID 62607059) has the molecular formula C13H16ClFO2 and a molecular weight of 258.72 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenyl)-3-(oxolan-2-yl)propan-2-ol.
| Compound Name | 1-(2-chloro-4-fluorophenyl)-3-(oxolan-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 62607059 |
| Molecular Formula | C13H16ClFO2 |
| Molecular Weight | 258.72 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 1-(2-chloro-4-fluorophenyl)-3-(oxolan-2-yl)propan-2-ol |
| SMILES | OC(Cc1ccc(F)cc1Cl)CC1CCCO1 |
| InChI | InChI=1S/C13H16ClFO2/c14-13-7-10(15)4-3-9(13)6-11(16)8-12-2-1-5-17-12/h3-4,7,11-12,16H,1-2,5-6,8H2 |
| InChIKey | RXJKTZRQKNBDMS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.72 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |