C16H22ClFO — CID 102623074
1-(2-chloro-5-fluorophenyl)-3-cycloheptylpropan-2-ol (PubChem CID 102623074) has the molecular formula C16H22ClFO and a molecular weight of 284.80 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)-3-cycloheptylpropan-2-ol.
| Compound Name | 1-(2-chloro-5-fluorophenyl)-3-cycloheptylpropan-2-ol |
|---|---|
| PubChem CID | 102623074 |
| Molecular Formula | C16H22ClFO |
| Molecular Weight | 284.80 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)-3-cycloheptylpropan-2-ol |
| SMILES | OC(Cc1cc(F)ccc1Cl)CC1CCCCCC1 |
| InChI | InChI=1S/C16H22ClFO/c17-16-8-7-14(18)10-13(16)11-15(19)9-12-5-3-1-2-4-6-12/h7-8,10,12,15,19H,1-6,9,11H2 |
| InChIKey | VYJUHPVAFWFJDS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.80 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |