C14H18F2O2 — CID 64560809
1-(2,4-difluorophenyl)-3-(oxan-4-yl)propan-2-ol (PubChem CID 64560809) has the molecular formula C14H18F2O2 and a molecular weight of 256.29 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(oxan-4-yl)propan-2-ol.
| Compound Name | 1-(2,4-difluorophenyl)-3-(oxan-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 64560809 |
| Molecular Formula | C14H18F2O2 |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(oxan-4-yl)propan-2-ol |
| SMILES | OC(Cc1ccc(F)cc1F)CC1CCOCC1 |
| InChI | InChI=1S/C14H18F2O2/c15-12-2-1-11(14(16)9-12)8-13(17)7-10-3-5-18-6-4-10/h1-2,9-10,13,17H,3-8H2 |
| InChIKey | ZBMWQBOUOVOKJE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |