C15H21FOS — CID 105131232
1-(4-fluoro-2-methylphenyl)-3-(thian-4-yl)propan-2-ol (PubChem CID 105131232) has the molecular formula C15H21FOS and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-(4-fluoro-2-methylphenyl)-3-(thian-4-yl)propan-2-ol.
| Compound Name | 1-(4-fluoro-2-methylphenyl)-3-(thian-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 105131232 |
| Molecular Formula | C15H21FOS |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 1-(4-fluoro-2-methylphenyl)-3-(thian-4-yl)propan-2-ol |
| SMILES | Cc1cc(F)ccc1CC(O)CC1CCSCC1 |
| InChI | InChI=1S/C15H21FOS/c1-11-8-14(16)3-2-13(11)10-15(17)9-12-4-6-18-7-5-12/h2-3,8,12,15,17H,4-7,9-10H2,1H3 |
| InChIKey | RUOLRFRTMXHDFG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |