C13H18FNS — CID 107295164
N-[(4-fluoro-2-methylphenyl)methyl]-1-(thiolan-3-yl)methanamine (PubChem CID 107295164) has the molecular formula C13H18FNS and a molecular weight of 239.36 g/mol. Its IUPAC name is N-[(4-fluoro-2-methylphenyl)methyl]-1-(thiolan-3-yl)methanamine.
| Compound Name | N-[(4-fluoro-2-methylphenyl)methyl]-1-(thiolan-3-yl)methanamine |
|---|---|
| PubChem CID | 107295164 |
| Molecular Formula | C13H18FNS |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | N-[(4-fluoro-2-methylphenyl)methyl]-1-(thiolan-3-yl)methanamine |
| SMILES | Cc1cc(F)ccc1CNCC1CCSC1 |
| InChI | InChI=1S/C13H18FNS/c1-10-6-13(14)3-2-12(10)8-15-7-11-4-5-16-9-11/h2-3,6,11,15H,4-5,7-9H2,1H3 |
| InChIKey | ODEODUDLVLSYDF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |