C15H17ClF4O — CID 102623125
2-(2-chloro-5-fluorophenyl)-1-[2-(trifluoromethyl)cyclohexyl]ethanol (PubChem CID 102623125) has the molecular formula C15H17ClF4O and a molecular weight of 324.75 g/mol. Its IUPAC name is 2-(2-chloro-5-fluorophenyl)-1-[2-(trifluoromethyl)cyclohexyl]ethanol.
| Compound Name | 2-(2-chloro-5-fluorophenyl)-1-[2-(trifluoromethyl)cyclohexyl]ethanol |
|---|---|
| PubChem CID | 102623125 |
| Molecular Formula | C15H17ClF4O |
| Molecular Weight | 324.75 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 2-(2-chloro-5-fluorophenyl)-1-[2-(trifluoromethyl)cyclohexyl]ethanol |
| SMILES | OC(Cc1cc(F)ccc1Cl)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C15H17ClF4O/c16-13-6-5-10(17)7-9(13)8-14(21)11-3-1-2-4-12(11)15(18,19)20/h5-7,11-12,14,21H,1-4,8H2 |
| InChIKey | RHDKYORRJYBWEP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.75 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |