C15H17F5O — CID 104622655
2-(2,3-difluorophenyl)-1-[2-(trifluoromethyl)cyclohexyl]ethanol (PubChem CID 104622655) has the molecular formula C15H17F5O and a molecular weight of 308.29 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-1-[2-(trifluoromethyl)cyclohexyl]ethanol.
| Compound Name | 2-(2,3-difluorophenyl)-1-[2-(trifluoromethyl)cyclohexyl]ethanol |
|---|---|
| PubChem CID | 104622655 |
| Molecular Formula | C15H17F5O |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2-(2,3-difluorophenyl)-1-[2-(trifluoromethyl)cyclohexyl]ethanol |
| SMILES | OC(Cc1cccc(F)c1F)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C15H17F5O/c16-12-7-3-4-9(14(12)17)8-13(21)10-5-1-2-6-11(10)15(18,19)20/h3-4,7,10-11,13,21H,1-2,5-6,8H2 |
| InChIKey | JBIRNDZWECIHAF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |