C15H16ClF5 — CID 104622698
1-[2-chloro-2-[2-(trifluoromethyl)cyclohexyl]ethyl]-2,3-difluorobenzene (PubChem CID 104622698) has the molecular formula C15H16ClF5 and a molecular weight of 326.74 g/mol. Its IUPAC name is 1-[2-chloro-2-[2-(trifluoromethyl)cyclohexyl]ethyl]-2,3-difluorobenzene.
| Compound Name | 1-[2-chloro-2-[2-(trifluoromethyl)cyclohexyl]ethyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 104622698 |
| Molecular Formula | C15H16ClF5 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 1-[2-chloro-2-[2-(trifluoromethyl)cyclohexyl]ethyl]-2,3-difluorobenzene |
| SMILES | Fc1cccc(CC(Cl)C2CCCCC2C(F)(F)F)c1F |
| InChI | InChI=1S/C15H16ClF5/c16-12(8-9-4-3-7-13(17)14(9)18)10-5-1-2-6-11(10)15(19,20)21/h3-4,7,10-12H,1-2,5-6,8H2 |
| InChIKey | ZLOVIVPMSSSMPD-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|