C15H16O3S — CID 106495123
1-(1-benzofuran-2-yl)-2-(oxolan-2-ylmethylsulfanyl)ethanone (PubChem CID 106495123) has the molecular formula C15H16O3S and a molecular weight of 276.36 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-2-(oxolan-2-ylmethylsulfanyl)ethanone.
| Compound Name | 1-(1-benzofuran-2-yl)-2-(oxolan-2-ylmethylsulfanyl)ethanone |
|---|---|
| PubChem CID | 106495123 |
| Molecular Formula | C15H16O3S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-2-(oxolan-2-ylmethylsulfanyl)ethanone |
| SMILES | O=C(CSCC1CCCO1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C15H16O3S/c16-13(10-19-9-12-5-3-7-17-12)15-8-11-4-1-2-6-14(11)18-15/h1-2,4,6,8,12H,3,5,7,9-10H2 |
| InChIKey | ATJGRNONZGKCQJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |