[2-(butylsulfanylmethyl)-4-methoxyphenyl]boronic acid

C12H19BO3S — CID 65327701

IUPAC[2-(butylsulfanylmethyl)-4-methoxyphenyl]boronic acid
SMILESCCCCSCc1cc(OC)ccc1B(O)O
InChIInChI=1S/C12H19BO3S/c1-3-4-7-17-9-10-8-11(16-2)5-6-12(10)13(14)15/h5-6,8,14-15H,3-4,7,9H2,1-2H3
InChIKeyOUQZHSNWGLXXIR-UHFFFAOYSA-N
MW254.16 g/mol
LogP1.41
Rot. Bonds7

About [2-(butylsulfanylmethyl)-4-methoxyphenyl]boronic acid

[2-(butylsulfanylmethyl)-4-methoxyphenyl]boronic acid (PubChem CID 65327701) has the molecular formula C12H19BO3S and a molecular weight of 254.16 g/mol. Its IUPAC name is [2-(butylsulfanylmethyl)-4-methoxyphenyl]boronic acid.

Molecular Properties

Compound Name[2-(butylsulfanylmethyl)-4-methoxyphenyl]boronic acid
PubChem CID65327701
Molecular FormulaC12H19BO3S
Molecular Weight254.16 g/mol
Exact Mass254.11
IUPAC Name[2-(butylsulfanylmethyl)-4-methoxyphenyl]boronic acid
SMILESCCCCSCc1cc(OC)ccc1B(O)O
InChIInChI=1S/C12H19BO3S/c1-3-4-7-17-9-10-8-11(16-2)5-6-12(10)13(14)15/h5-6,8,14-15H,3-4,7,9H2,1-2H3
InChIKeyOUQZHSNWGLXXIR-UHFFFAOYSA-N
XLogP1.41
TPSA49.69 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.16
LogP ≤ 51.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [2-(butylsulfanylmethyl)-4-methoxyphenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(butylsulfanylmethyl)-4-methoxyphenyl]boronic acid?
The IUPAC name of [2-(butylsulfanylmethyl)-4-methoxyphenyl]boronic acid (CID 65327701) is [2-(butylsulfanylmethyl)-4-methoxyphenyl]boronic acid.
What is the SMILES notation for [2-(butylsulfanylmethyl)-4-methoxyphenyl]boronic acid?
The canonical SMILES for [2-(butylsulfanylmethyl)-4-methoxyphenyl]boronic acid is CCCCSCc1cc(OC)ccc1B(O)O.
What is the InChIKey of [2-(butylsulfanylmethyl)-4-methoxyphenyl]boronic acid?
The InChIKey is OUQZHSNWGLXXIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19BO3S/c1-3-4-7-17-9-10-8-11(16-2)5-6-12(10)13(14)15/h5-6,8,14-15H,3-4,7,9H2,1-2H3.
What are the key properties of [2-(butylsulfanylmethyl)-4-methoxyphenyl]boronic acid?
[2-(butylsulfanylmethyl)-4-methoxyphenyl]boronic acid has a molecular weight of 254.16 g/mol, XLogP of 1.41, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(butylsulfanylmethyl)-4-methoxyphenyl]boronic acid is sourced from PubChem (CID 65327701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).