C16H19BO3S — CID 65328035
[2-[(2,4-dimethylphenyl)sulfanylmethyl]-4-methoxyphenyl]boronic acid (PubChem CID 65328035) has the molecular formula C16H19BO3S and a molecular weight of 302.20 g/mol. Its IUPAC name is [2-[(2,4-dimethylphenyl)sulfanylmethyl]-4-methoxyphenyl]boronic acid.
| Compound Name | [2-[(2,4-dimethylphenyl)sulfanylmethyl]-4-methoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 65328035 |
| Molecular Formula | C16H19BO3S |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | [2-[(2,4-dimethylphenyl)sulfanylmethyl]-4-methoxyphenyl]boronic acid |
| SMILES | COc1ccc(B(O)O)c(CSc2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C16H19BO3S/c1-11-4-7-16(12(2)8-11)21-10-13-9-14(20-3)5-6-15(13)17(18)19/h4-9,18-19H,10H2,1-3H3 |
| InChIKey | JKWZPQQNEXBBCN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|