C14H14FNO4 — CID 79468265
3-[5-fluoro-2-[(3-oxomorpholin-4-yl)methyl]phenyl]prop-2-enoic acid (PubChem CID 79468265) has the molecular formula C14H14FNO4 and a molecular weight of 279.27 g/mol. Its IUPAC name is 3-[5-fluoro-2-[(3-oxomorpholin-4-yl)methyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[5-fluoro-2-[(3-oxomorpholin-4-yl)methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 79468265 |
| Molecular Formula | C14H14FNO4 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 3-[5-fluoro-2-[(3-oxomorpholin-4-yl)methyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cc(F)ccc1CN1CCOCC1=O |
| InChI | InChI=1S/C14H14FNO4/c15-12-3-1-11(10(7-12)2-4-14(18)19)8-16-5-6-20-9-13(16)17/h1-4,7H,5-6,8-9H2,(H,18,19) |
| InChIKey | NRGRZHQVNQQXSP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|