C13H10ClFN2O2 — CID 109375516
(E)-3-[2-[(4-chloropyrazol-1-yl)methyl]-5-fluorophenyl]prop-2-enoic acid (PubChem CID 109375516) has the molecular formula C13H10ClFN2O2 and a molecular weight of 280.69 g/mol. Its IUPAC name is (E)-3-[2-[(4-chloropyrazol-1-yl)methyl]-5-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[(4-chloropyrazol-1-yl)methyl]-5-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 109375516 |
| Molecular Formula | C13H10ClFN2O2 |
| Molecular Weight | 280.69 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | (E)-3-[2-[(4-chloropyrazol-1-yl)methyl]-5-fluorophenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(F)ccc1Cn1cc(Cl)cn1 |
| InChI | InChI=1S/C13H10ClFN2O2/c14-11-6-16-17(8-11)7-10-1-3-12(15)5-9(10)2-4-13(18)19/h1-6,8H,7H2,(H,18,19)/b4-2+ |
| InChIKey | NUWNDHCPGLHDTO-DUXPYHPUSA-N |
| XLogP | 2.82 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.69 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|