C15H18FNO3 — CID 76979620
3-[3-fluoro-4-(1,4-oxazepan-4-ylmethyl)phenyl]prop-2-enoic acid (PubChem CID 76979620) has the molecular formula C15H18FNO3 and a molecular weight of 279.31 g/mol. Its IUPAC name is 3-[3-fluoro-4-(1,4-oxazepan-4-ylmethyl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-fluoro-4-(1,4-oxazepan-4-ylmethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76979620 |
| Molecular Formula | C15H18FNO3 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 3-[3-fluoro-4-(1,4-oxazepan-4-ylmethyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(CN2CCCOCC2)c(F)c1 |
| InChI | InChI=1S/C15H18FNO3/c16-14-10-12(3-5-15(18)19)2-4-13(14)11-17-6-1-8-20-9-7-17/h2-5,10H,1,6-9,11H2,(H,18,19) |
| InChIKey | VHFWUIJLVLJVGY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|