C15H17FN2O3 — CID 77052046
3-[3-fluoro-4-[(4-methyl-3-oxopiperazin-1-yl)methyl]phenyl]prop-2-enoic acid (PubChem CID 77052046) has the molecular formula C15H17FN2O3 and a molecular weight of 292.31 g/mol. Its IUPAC name is 3-[3-fluoro-4-[(4-methyl-3-oxopiperazin-1-yl)methyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-fluoro-4-[(4-methyl-3-oxopiperazin-1-yl)methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77052046 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-[3-fluoro-4-[(4-methyl-3-oxopiperazin-1-yl)methyl]phenyl]prop-2-enoic acid |
| SMILES | CN1CCN(Cc2ccc(C=CC(=O)O)cc2F)CC1=O |
| InChI | InChI=1S/C15H17FN2O3/c1-17-6-7-18(10-14(17)19)9-12-4-2-11(8-13(12)16)3-5-15(20)21/h2-5,8H,6-7,9-10H2,1H3,(H,20,21) |
| InChIKey | JTRYZYMEKOVHDA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|