C21H28ClN3O4 — CID 108916182
tert-butyl N-[2-[4-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-1,4-diazepan-1-yl]-2-oxoethyl]carbamate (PubChem CID 108916182) has the molecular formula C21H28ClN3O4 and a molecular weight of 421.93 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-1,4-diazepan-1-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-1,4-diazepan-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108916182 |
| Molecular Formula | C21H28ClN3O4 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | tert-butyl N-[2-[4-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-1,4-diazepan-1-yl]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N1CCCN(C(=O)/C=C/c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C21H28ClN3O4/c1-21(2,3)29-20(28)23-15-19(27)25-11-5-10-24(12-13-25)18(26)9-8-16-6-4-7-17(22)14-16/h4,6-9,14H,5,10-13,15H2,1-3H3,(H,23,28)/b9-8+ |
| InChIKey | DMKULXKYAKLSMH-CMDGGOBGSA-N |
| XLogP | 2.94 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|