C14H14ClN5O2 — CID 86819891
4-[(6-amino-3-pyridinyl)methylcarbamoylamino]-2-chlorobenzamide (PubChem CID 86819891) has the molecular formula C14H14ClN5O2 and a molecular weight of 319.75 g/mol. Its IUPAC name is 4-[(6-amino-3-pyridinyl)methylcarbamoylamino]-2-chlorobenzamide.
| Compound Name | 4-[(6-amino-3-pyridinyl)methylcarbamoylamino]-2-chlorobenzamide |
|---|---|
| PubChem CID | 86819891 |
| Molecular Formula | C14H14ClN5O2 |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 4-[(6-amino-3-pyridinyl)methylcarbamoylamino]-2-chlorobenzamide |
| SMILES | NC(=O)c1ccc(NC(=O)NCc2ccc(N)nc2)cc1Cl |
| InChI | InChI=1S/C14H14ClN5O2/c15-11-5-9(2-3-10(11)13(17)21)20-14(22)19-7-8-1-4-12(16)18-6-8/h1-6H,7H2,(H2,16,18)(H2,17,21)(H2,19,20,22) |
| InChIKey | FDDKZKLLBPKPPD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |