C9H9Cl2N3OS — CID 61127485
1-(2-amino-2-sulfanylideneethyl)-3-(3,4-dichlorophenyl)urea (PubChem CID 61127485) has the molecular formula C9H9Cl2N3OS and a molecular weight of 278.16 g/mol. Its IUPAC name is 1-(2-amino-2-sulfanylideneethyl)-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-(2-amino-2-sulfanylideneethyl)-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 61127485 |
| Molecular Formula | C9H9Cl2N3OS |
| Molecular Weight | 278.16 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | 1-(2-amino-2-sulfanylideneethyl)-3-(3,4-dichlorophenyl)urea |
| SMILES | NC(=S)CNC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H9Cl2N3OS/c10-6-2-1-5(3-7(6)11)14-9(15)13-4-8(12)16/h1-3H,4H2,(H2,12,16)(H2,13,14,15) |
| InChIKey | PETJRXVAAQMFFI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.16 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|