C12H10Cl3N5O — CID 122194201
1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(3,4-dichlorophenyl)urea (PubChem CID 122194201) has the molecular formula C12H10Cl3N5O and a molecular weight of 346.61 g/mol. Its IUPAC name is 1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 122194201 |
| Molecular Formula | C12H10Cl3N5O |
| Molecular Weight | 346.61 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(3,4-dichlorophenyl)urea |
| SMILES | Nc1ncc(Cl)nc1CNC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H10Cl3N5O/c13-7-2-1-6(3-8(7)14)19-12(21)18-4-9-11(16)17-5-10(15)20-9/h1-3,5H,4H2,(H2,16,17)(H2,18,19,21) |
| InChIKey | YTICONKGHBUNKO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.61 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |