C13H9N3O2 — CID 110728684
N-(1,3-benzoxazol-5-yl)pyridine-4-carboxamide (PubChem CID 110728684) has the molecular formula C13H9N3O2 and a molecular weight of 239.23 g/mol. Its IUPAC name is N-(1,3-benzoxazol-5-yl)pyridine-4-carboxamide.
| Compound Name | N-(1,3-benzoxazol-5-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 110728684 |
| Molecular Formula | C13H9N3O2 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | N-(1,3-benzoxazol-5-yl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc2ocnc2c1)c1ccncc1 |
| InChI | InChI=1S/C13H9N3O2/c17-13(9-3-5-14-6-4-9)16-10-1-2-12-11(7-10)15-8-18-12/h1-8H,(H,16,17) |
| InChIKey | KEROWDRYBPIANI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |