C11H13N3O2 — CID 116845001
3-(1,3-benzoxazol-6-yl)-N-methylpropanehydrazide (PubChem CID 116845001) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-6-yl)-N-methylpropanehydrazide.
| Compound Name | 3-(1,3-benzoxazol-6-yl)-N-methylpropanehydrazide |
|---|---|
| PubChem CID | 116845001 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 3-(1,3-benzoxazol-6-yl)-N-methylpropanehydrazide |
| SMILES | CN(N)C(=O)CCc1ccc2ncoc2c1 |
| InChI | InChI=1S/C11H13N3O2/c1-14(12)11(15)5-3-8-2-4-9-10(6-8)16-7-13-9/h2,4,6-7H,3,5,12H2,1H3 |
| InChIKey | ULKGTDMBOBFUKH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|