C11H14N2O2 — CID 115229523
[2-(1,3-benzoxazol-6-yl)ethyl-methylamino]methanol (PubChem CID 115229523) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is [2-(1,3-benzoxazol-6-yl)ethyl-methylamino]methanol.
| Compound Name | [2-(1,3-benzoxazol-6-yl)ethyl-methylamino]methanol |
|---|---|
| PubChem CID | 115229523 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | [2-(1,3-benzoxazol-6-yl)ethyl-methylamino]methanol |
| SMILES | CN(CO)CCc1ccc2ncoc2c1 |
| InChI | InChI=1S/C11H14N2O2/c1-13(8-14)5-4-9-2-3-10-11(6-9)15-7-12-10/h2-3,6-7,14H,4-5,8H2,1H3 |
| InChIKey | OQLYHHHTTQEWAH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|