C12H16N2O3 — CID 115122233
3-[1,3-benzoxazol-6-ylmethyl(methyl)amino]propane-1,2-diol (PubChem CID 115122233) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 3-[1,3-benzoxazol-6-ylmethyl(methyl)amino]propane-1,2-diol.
| Compound Name | 3-[1,3-benzoxazol-6-ylmethyl(methyl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 115122233 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 3-[1,3-benzoxazol-6-ylmethyl(methyl)amino]propane-1,2-diol |
| SMILES | CN(Cc1ccc2ncoc2c1)CC(O)CO |
| InChI | InChI=1S/C12H16N2O3/c1-14(6-10(16)7-15)5-9-2-3-11-12(4-9)17-8-13-11/h2-4,8,10,15-16H,5-7H2,1H3 |
| InChIKey | UTSKDQYNLHAZDD-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |