C10H12N2O2 — CID 116859184
1-amino-3-(1,3-benzoxazol-6-yl)propan-2-ol (PubChem CID 116859184) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 1-amino-3-(1,3-benzoxazol-6-yl)propan-2-ol.
| Compound Name | 1-amino-3-(1,3-benzoxazol-6-yl)propan-2-ol |
|---|---|
| PubChem CID | 116859184 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 1-amino-3-(1,3-benzoxazol-6-yl)propan-2-ol |
| SMILES | NCC(O)Cc1ccc2ncoc2c1 |
| InChI | InChI=1S/C10H12N2O2/c11-5-8(13)3-7-1-2-9-10(4-7)14-6-12-9/h1-2,4,6,8,13H,3,5,11H2 |
| InChIKey | ZBTUXIVGXSQRGZ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |