C13H18N2O — CID 116931858
2-(1,3-benzoxazol-6-ylmethyl)-N-methylbutan-1-amine (PubChem CID 116931858) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-6-ylmethyl)-N-methylbutan-1-amine.
| Compound Name | 2-(1,3-benzoxazol-6-ylmethyl)-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 116931858 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 2-(1,3-benzoxazol-6-ylmethyl)-N-methylbutan-1-amine |
| SMILES | CCC(CNC)Cc1ccc2ncoc2c1 |
| InChI | InChI=1S/C13H18N2O/c1-3-10(8-14-2)6-11-4-5-12-13(7-11)16-9-15-12/h4-5,7,9-10,14H,3,6,8H2,1-2H3 |
| InChIKey | VUALNPJKTMNCAF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |