C12H14N2O4 — CID 115123039
4-(1,3-benzoxazol-6-ylmethylamino)-3-hydroxybutanoic acid (PubChem CID 115123039) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-6-ylmethylamino)-3-hydroxybutanoic acid.
| Compound Name | 4-(1,3-benzoxazol-6-ylmethylamino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 115123039 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 4-(1,3-benzoxazol-6-ylmethylamino)-3-hydroxybutanoic acid |
| SMILES | O=C(O)CC(O)CNCc1ccc2ncoc2c1 |
| InChI | InChI=1S/C12H14N2O4/c15-9(4-12(16)17)6-13-5-8-1-2-10-11(3-8)18-7-14-10/h1-3,7,9,13,15H,4-6H2,(H,16,17) |
| InChIKey | MZJNVZWYODMHKC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |