4-(1,3-benzoxazol-6-ylmethylamino)-3-hydroxybutanoic acid

C12H14N2O4 — CID 115123039

IUPAC4-(1,3-benzoxazol-6-ylmethylamino)-3-hydroxybutanoic acid
SMILESO=C(O)CC(O)CNCc1ccc2ncoc2c1
InChIInChI=1S/C12H14N2O4/c15-9(4-12(16)17)6-13-5-8-1-2-10-11(3-8)18-7-14-10/h1-3,7,9,13,15H,4-6H2,(H,16,17)
InChIKeyMZJNVZWYODMHKC-UHFFFAOYSA-N
MW250.25 g/mol
LogP0.75
Rot. Bonds6

About 4-(1,3-benzoxazol-6-ylmethylamino)-3-hydroxybutanoic acid

4-(1,3-benzoxazol-6-ylmethylamino)-3-hydroxybutanoic acid (PubChem CID 115123039) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-6-ylmethylamino)-3-hydroxybutanoic acid.

Molecular Properties

Compound Name4-(1,3-benzoxazol-6-ylmethylamino)-3-hydroxybutanoic acid
PubChem CID115123039
Molecular FormulaC12H14N2O4
Molecular Weight250.25 g/mol
Exact Mass250.10
IUPAC Name4-(1,3-benzoxazol-6-ylmethylamino)-3-hydroxybutanoic acid
SMILESO=C(O)CC(O)CNCc1ccc2ncoc2c1
InChIInChI=1S/C12H14N2O4/c15-9(4-12(16)17)6-13-5-8-1-2-10-11(3-8)18-7-14-10/h1-3,7,9,13,15H,4-6H2,(H,16,17)
InChIKeyMZJNVZWYODMHKC-UHFFFAOYSA-N
XLogP0.75
TPSA95.59 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.25
LogP ≤ 50.75
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 4-(1,3-benzoxazol-6-ylmethylamino)-3-hydroxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,3-benzoxazol-6-ylmethylamino)-3-hydroxybutanoic acid?
The IUPAC name of 4-(1,3-benzoxazol-6-ylmethylamino)-3-hydroxybutanoic acid (CID 115123039) is 4-(1,3-benzoxazol-6-ylmethylamino)-3-hydroxybutanoic acid.
What is the SMILES notation for 4-(1,3-benzoxazol-6-ylmethylamino)-3-hydroxybutanoic acid?
The canonical SMILES for 4-(1,3-benzoxazol-6-ylmethylamino)-3-hydroxybutanoic acid is O=C(O)CC(O)CNCc1ccc2ncoc2c1.
What is the InChIKey of 4-(1,3-benzoxazol-6-ylmethylamino)-3-hydroxybutanoic acid?
The InChIKey is MZJNVZWYODMHKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O4/c15-9(4-12(16)17)6-13-5-8-1-2-10-11(3-8)18-7-14-10/h1-3,7,9,13,15H,4-6H2,(H,16,17).
What are the key properties of 4-(1,3-benzoxazol-6-ylmethylamino)-3-hydroxybutanoic acid?
4-(1,3-benzoxazol-6-ylmethylamino)-3-hydroxybutanoic acid has a molecular weight of 250.25 g/mol, XLogP of 0.75, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzoxazol-6-ylmethylamino)-3-hydroxybutanoic acid is sourced from PubChem (CID 115123039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).