C11H15N3O2 — CID 115121411
1-amino-3-(1,3-benzoxazol-6-ylmethylamino)propan-2-ol (PubChem CID 115121411) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 1-amino-3-(1,3-benzoxazol-6-ylmethylamino)propan-2-ol.
| Compound Name | 1-amino-3-(1,3-benzoxazol-6-ylmethylamino)propan-2-ol |
|---|---|
| PubChem CID | 115121411 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 1-amino-3-(1,3-benzoxazol-6-ylmethylamino)propan-2-ol |
| SMILES | NCC(O)CNCc1ccc2ncoc2c1 |
| InChI | InChI=1S/C11H15N3O2/c12-4-9(15)6-13-5-8-1-2-10-11(3-8)16-7-14-10/h1-3,7,9,13,15H,4-6,12H2 |
| InChIKey | CCFZFWGSCOHBRZ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |