C14H18N2O2 — CID 115236616
5-[1,3-benzoxazol-6-ylmethyl(methyl)amino]pentan-2-one (PubChem CID 115236616) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 5-[1,3-benzoxazol-6-ylmethyl(methyl)amino]pentan-2-one.
| Compound Name | 5-[1,3-benzoxazol-6-ylmethyl(methyl)amino]pentan-2-one |
|---|---|
| PubChem CID | 115236616 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 5-[1,3-benzoxazol-6-ylmethyl(methyl)amino]pentan-2-one |
| SMILES | CC(=O)CCCN(C)Cc1ccc2ncoc2c1 |
| InChI | InChI=1S/C14H18N2O2/c1-11(17)4-3-7-16(2)9-12-5-6-13-14(8-12)18-10-15-13/h5-6,8,10H,3-4,7,9H2,1-2H3 |
| InChIKey | CSGDVPPGXWYKOB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |