C15H21N3O — CID 115118528
N-[2-(1,3-benzoxazol-6-yl)ethyl]-N-methylpiperidin-4-amine (PubChem CID 115118528) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is N-[2-(1,3-benzoxazol-6-yl)ethyl]-N-methylpiperidin-4-amine.
| Compound Name | N-[2-(1,3-benzoxazol-6-yl)ethyl]-N-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 115118528 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N-[2-(1,3-benzoxazol-6-yl)ethyl]-N-methylpiperidin-4-amine |
| SMILES | CN(CCc1ccc2ncoc2c1)C1CCNCC1 |
| InChI | InChI=1S/C15H21N3O/c1-18(13-4-7-16-8-5-13)9-6-12-2-3-14-15(10-12)19-11-17-14/h2-3,10-11,13,16H,4-9H2,1H3 |
| InChIKey | OOJGVFWPZCTJQV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |