C12H11N3O2 — CID 115172688
N-[2-(1,3-benzoxazol-6-yl)ethyl]-1-cyano-N-methylformamide (PubChem CID 115172688) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is N-[2-(1,3-benzoxazol-6-yl)ethyl]-1-cyano-N-methylformamide.
| Compound Name | N-[2-(1,3-benzoxazol-6-yl)ethyl]-1-cyano-N-methylformamide |
|---|---|
| PubChem CID | 115172688 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-[2-(1,3-benzoxazol-6-yl)ethyl]-1-cyano-N-methylformamide |
| SMILES | CN(CCc1ccc2ncoc2c1)C(=O)C#N |
| InChI | InChI=1S/C12H11N3O2/c1-15(12(16)7-13)5-4-9-2-3-10-11(6-9)17-8-14-10/h2-3,6,8H,4-5H2,1H3 |
| InChIKey | JSUFUMYURXIFRH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|