C13H16N2O3 — CID 110786464
3-methyl-N-[(2-oxo-3H-1,3-benzoxazol-6-yl)methyl]butanamide (PubChem CID 110786464) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-methyl-N-[(2-oxo-3H-1,3-benzoxazol-6-yl)methyl]butanamide.
| Compound Name | 3-methyl-N-[(2-oxo-3H-1,3-benzoxazol-6-yl)methyl]butanamide |
|---|---|
| PubChem CID | 110786464 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 3-methyl-N-[(2-oxo-3H-1,3-benzoxazol-6-yl)methyl]butanamide |
| SMILES | CC(C)CC(=O)NCc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C13H16N2O3/c1-8(2)5-12(16)14-7-9-3-4-10-11(6-9)18-13(17)15-10/h3-4,6,8H,5,7H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | TUCKQGSRAMRJQD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |