C11H8Cl2N4O3 — CID 27102156
1-(3,4-dichlorophenyl)-3-(2,4-dioxo-1H-pyrimidin-6-yl)urea (PubChem CID 27102156) has the molecular formula C11H8Cl2N4O3 and a molecular weight of 315.12 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(2,4-dioxo-1H-pyrimidin-6-yl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(2,4-dioxo-1H-pyrimidin-6-yl)urea |
|---|---|
| PubChem CID | 27102156 |
| Molecular Formula | C11H8Cl2N4O3 |
| Molecular Weight | 315.12 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(2,4-dioxo-1H-pyrimidin-6-yl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C11H8Cl2N4O3/c12-6-2-1-5(3-7(6)13)14-10(19)15-8-4-9(18)17-11(20)16-8/h1-4H,(H4,14,15,16,17,18,19,20) |
| InChIKey | XDWYSVVCDGWGKY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.12 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |