C17H17ClO — CID 62503763
2-(3-chlorophenyl)-1-(2,3-dihydro-1H-inden-5-yl)ethanol (PubChem CID 62503763) has the molecular formula C17H17ClO and a molecular weight of 272.78 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-(2,3-dihydro-1H-inden-5-yl)ethanol.
| Compound Name | 2-(3-chlorophenyl)-1-(2,3-dihydro-1H-inden-5-yl)ethanol |
|---|---|
| PubChem CID | 62503763 |
| Molecular Formula | C17H17ClO |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-(3-chlorophenyl)-1-(2,3-dihydro-1H-inden-5-yl)ethanol |
| SMILES | OC(Cc1cccc(Cl)c1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H17ClO/c18-16-6-1-3-12(9-16)10-17(19)15-8-7-13-4-2-5-14(13)11-15/h1,3,6-9,11,17,19H,2,4-5,10H2 |
| InChIKey | GFGAUDYVNPTDDR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |