C15H23BrN2O2 — CID 103720725
N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-N'-ethyl-N'-propylethane-1,2-diamine (PubChem CID 103720725) has the molecular formula C15H23BrN2O2 and a molecular weight of 343.27 g/mol. Its IUPAC name is N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-N'-ethyl-N'-propylethane-1,2-diamine.
| Compound Name | N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-N'-ethyl-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 103720725 |
| Molecular Formula | C15H23BrN2O2 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-N'-ethyl-N'-propylethane-1,2-diamine |
| SMILES | CCCN(CC)CCNCc1cc(Br)c2c(c1)OCO2 |
| InChI | InChI=1S/C15H23BrN2O2/c1-3-6-18(4-2)7-5-17-10-12-8-13(16)15-14(9-12)19-11-20-15/h8-9,17H,3-7,10-11H2,1-2H3 |
| InChIKey | VGCZRHREJLTFJX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|