C14H20BrNO4 — CID 43217195
N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine (PubChem CID 43217195) has the molecular formula C14H20BrNO4 and a molecular weight of 346.22 g/mol. Its IUPAC name is N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine.
| Compound Name | N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine |
|---|---|
| PubChem CID | 43217195 |
| Molecular Formula | C14H20BrNO4 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine |
| SMILES | COCCOCCCNCc1cc(Br)c2c(c1)OCO2 |
| InChI | InChI=1S/C14H20BrNO4/c1-17-5-6-18-4-2-3-16-9-11-7-12(15)14-13(8-11)19-10-20-14/h7-8,16H,2-6,9-10H2,1H3 |
| InChIKey | SUCPDCGBTKDCML-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|