C13H18BrNO3 — CID 107302875
5-[(7-bromo-1,3-benzodioxol-5-yl)methylamino]pentan-1-ol (PubChem CID 107302875) has the molecular formula C13H18BrNO3 and a molecular weight of 316.20 g/mol. Its IUPAC name is 5-[(7-bromo-1,3-benzodioxol-5-yl)methylamino]pentan-1-ol.
| Compound Name | 5-[(7-bromo-1,3-benzodioxol-5-yl)methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 107302875 |
| Molecular Formula | C13H18BrNO3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 5-[(7-bromo-1,3-benzodioxol-5-yl)methylamino]pentan-1-ol |
| SMILES | OCCCCCNCc1cc(Br)c2c(c1)OCO2 |
| InChI | InChI=1S/C13H18BrNO3/c14-11-6-10(7-12-13(11)18-9-17-12)8-15-4-2-1-3-5-16/h6-7,15-16H,1-5,8-9H2 |
| InChIKey | CZVWOBSRKKOPNQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|