C14H10BrCl2NO2 — CID 43326664
N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2,3-dichloroaniline (PubChem CID 43326664) has the molecular formula C14H10BrCl2NO2 and a molecular weight of 375.05 g/mol. Its IUPAC name is N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2,3-dichloroaniline.
| Compound Name | N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2,3-dichloroaniline |
|---|---|
| PubChem CID | 43326664 |
| Molecular Formula | C14H10BrCl2NO2 |
| Molecular Weight | 375.05 g/mol |
| Exact Mass | 372.93 |
| IUPAC Name | N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2,3-dichloroaniline |
| SMILES | Clc1cccc(NCc2cc(Br)c3c(c2)OCO3)c1Cl |
| InChI | InChI=1S/C14H10BrCl2NO2/c15-9-4-8(5-12-14(9)20-7-19-12)6-18-11-3-1-2-10(16)13(11)17/h1-5,18H,6-7H2 |
| InChIKey | WFOPYVLYTIGPSY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.05 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |