C13H9Br2Cl2N — CID 113483253
2,3-dichloro-N-[(3,4-dibromophenyl)methyl]aniline (PubChem CID 113483253) has the molecular formula C13H9Br2Cl2N and a molecular weight of 409.94 g/mol. Its IUPAC name is 2,3-dichloro-N-[(3,4-dibromophenyl)methyl]aniline.
| Compound Name | 2,3-dichloro-N-[(3,4-dibromophenyl)methyl]aniline |
|---|---|
| PubChem CID | 113483253 |
| Molecular Formula | C13H9Br2Cl2N |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 406.85 |
| IUPAC Name | 2,3-dichloro-N-[(3,4-dibromophenyl)methyl]aniline |
| SMILES | Clc1cccc(NCc2ccc(Br)c(Br)c2)c1Cl |
| InChI | InChI=1S/C13H9Br2Cl2N/c14-9-5-4-8(6-10(9)15)7-18-12-3-1-2-11(16)13(12)17/h1-6,18H,7H2 |
| InChIKey | QSOCSBPBHDEFIX-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |