C16H16BrNO3 — CID 43143807
N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-ethoxyaniline (PubChem CID 43143807) has the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. Its IUPAC name is N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-ethoxyaniline.
| Compound Name | N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-ethoxyaniline |
|---|---|
| PubChem CID | 43143807 |
| Molecular Formula | C16H16BrNO3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-ethoxyaniline |
| SMILES | CCOc1ccccc1NCc1cc(Br)c2c(c1)OCO2 |
| InChI | InChI=1S/C16H16BrNO3/c1-2-19-14-6-4-3-5-13(14)18-9-11-7-12(17)16-15(8-11)20-10-21-16/h3-8,18H,2,9-10H2,1H3 |
| InChIKey | ZDWJGQCMEMIQTP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |