C16H16BrNO3 — CID 62865767
N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-4-methoxy-2-methylaniline (PubChem CID 62865767) has the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. Its IUPAC name is N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-4-methoxy-2-methylaniline.
| Compound Name | N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-4-methoxy-2-methylaniline |
|---|---|
| PubChem CID | 62865767 |
| Molecular Formula | C16H16BrNO3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-4-methoxy-2-methylaniline |
| SMILES | COc1ccc(NCc2cc(Br)c3c(c2)OCO3)c(C)c1 |
| InChI | InChI=1S/C16H16BrNO3/c1-10-5-12(19-2)3-4-14(10)18-8-11-6-13(17)16-15(7-11)20-9-21-16/h3-7,18H,8-9H2,1-2H3 |
| InChIKey | QANXAVBENMMALJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|