About isocyanatobenzene;sulfuryl diisocyanate
isocyanatobenzene;sulfuryl diisocyanate (PubChem CID 87082915) has the molecular formula C9H5N3O5S
and a molecular weight of 267.22 g/mol. Its IUPAC name is isocyanatobenzene;sulfuryl diisocyanate.
Molecular Properties
| Compound Name | isocyanatobenzene;sulfuryl diisocyanate |
| PubChem CID | 87082915 |
| Molecular Formula | C9H5N3O5S |
| Molecular Weight | 267.22 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | isocyanatobenzene;sulfuryl diisocyanate |
| SMILES | O=C=NS(=O)(=O)N=C=O.O=C=Nc1ccccc1 |
| InChI | InChI=1S/C7H5NO.C2N2O4S/c9-6-8-7-4-2-1-3-5-7;5-1-3-9(7,8)4-2-6/h1-5H; |
| InChIKey | QPAMVUHBZUMPQC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 122.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze isocyanatobenzene;sulfuryl diisocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isocyanatobenzene;sulfuryl diisocyanate?
The IUPAC name of isocyanatobenzene;sulfuryl diisocyanate (CID 87082915) is isocyanatobenzene;sulfuryl diisocyanate.
What is the SMILES notation for isocyanatobenzene;sulfuryl diisocyanate?
The canonical SMILES for isocyanatobenzene;sulfuryl diisocyanate is O=C=NS(=O)(=O)N=C=O.O=C=Nc1ccccc1.
What is the InChIKey of isocyanatobenzene;sulfuryl diisocyanate?
The InChIKey is QPAMVUHBZUMPQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO.C2N2O4S/c9-6-8-7-4-2-1-3-5-7;5-1-3-9(7,8)4-2-6/h1-5H;.
What are the key properties of isocyanatobenzene;sulfuryl diisocyanate?
isocyanatobenzene;sulfuryl diisocyanate has a molecular weight of 267.22 g/mol, XLogP of 0.56, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for isocyanatobenzene;sulfuryl diisocyanate is sourced from PubChem (CID 87082915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).