C11H12ClNO2S — CID 171893813
4-chloro-1-(3-isothiocyanatophenyl)butane-1,2-diol (PubChem CID 171893813) has the molecular formula C11H12ClNO2S and a molecular weight of 257.74 g/mol. Its IUPAC name is 4-chloro-1-(3-isothiocyanatophenyl)butane-1,2-diol.
| Compound Name | 4-chloro-1-(3-isothiocyanatophenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171893813 |
| Molecular Formula | C11H12ClNO2S |
| Molecular Weight | 257.74 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 4-chloro-1-(3-isothiocyanatophenyl)butane-1,2-diol |
| SMILES | OC(CCCl)C(O)c1cccc(N=C=S)c1 |
| InChI | InChI=1S/C11H12ClNO2S/c12-5-4-10(14)11(15)8-2-1-3-9(6-8)13-7-16/h1-3,6,10-11,14-15H,4-5H2 |
| InChIKey | VRXMZINVXZMZBE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.74 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|