C11H15N5O2 — CID 171879435
3-(4-azido-1,2-dihydroxybutyl)benzenecarboximidamide (PubChem CID 171879435) has the molecular formula C11H15N5O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is 3-(4-azido-1,2-dihydroxybutyl)benzenecarboximidamide.
| Compound Name | 3-(4-azido-1,2-dihydroxybutyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 171879435 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 3-(4-azido-1,2-dihydroxybutyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(C(O)C(O)CCN=[N+]=[N-])c1 |
| InChI | InChI=1S/C11H15N5O2/c12-11(13)8-3-1-2-7(6-8)10(18)9(17)4-5-15-16-14/h1-3,6,9-10,17-18H,4-5H2,(H3,12,13) |
| InChIKey | LDMDIGYAKPBTRN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 139.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|