C11H15BrN2O2 — CID 171891979
3-(4-bromo-1,2-dihydroxybutyl)benzenecarboximidamide (PubChem CID 171891979) has the molecular formula C11H15BrN2O2 and a molecular weight of 287.16 g/mol. Its IUPAC name is 3-(4-bromo-1,2-dihydroxybutyl)benzenecarboximidamide.
| Compound Name | 3-(4-bromo-1,2-dihydroxybutyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 171891979 |
| Molecular Formula | C11H15BrN2O2 |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 3-(4-bromo-1,2-dihydroxybutyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(C(O)C(O)CCBr)c1 |
| InChI | InChI=1S/C11H15BrN2O2/c12-5-4-9(15)10(16)7-2-1-3-8(6-7)11(13)14/h1-3,6,9-10,15-16H,4-5H2,(H3,13,14) |
| InChIKey | JXJSQROJTNVJFJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|