C10H13ClN2O2 — CID 171862004
3-(3-chloro-1,2-dihydroxypropyl)benzenecarboximidamide (PubChem CID 171862004) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is 3-(3-chloro-1,2-dihydroxypropyl)benzenecarboximidamide.
| Compound Name | 3-(3-chloro-1,2-dihydroxypropyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 171862004 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 3-(3-chloro-1,2-dihydroxypropyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(C(O)C(O)CCl)c1 |
| InChI | InChI=1S/C10H13ClN2O2/c11-5-8(14)9(15)6-2-1-3-7(4-6)10(12)13/h1-4,8-9,14-15H,5H2,(H3,12,13) |
| InChIKey | JBGRGFSGTQBLJF-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|